C26H26BrNO7 — CID 91271855
2-O-[2-[7-(2-bromoacetyl)dibenzofuran-3-yl]-2-oxoethyl] 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate (PubChem CID 91271855) has the molecular formula C26H26BrNO7 and a molecular weight of 544.40 g/mol. Its IUPAC name is 2-O-[2-[7-(2-bromoacetyl)dibenzofuran-3-yl]-2-oxoethyl] 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[7-(2-bromoacetyl)dibenzofuran-3-yl]-2-oxoethyl] 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91271855 |
| Molecular Formula | C26H26BrNO7 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | 2-O-[2-[7-(2-bromoacetyl)dibenzofuran-3-yl]-2-oxoethyl] 1-O-tert-butyl (2R)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C(=O)OCC(=O)c1ccc2c(c1)oc1cc(C(=O)CBr)ccc12 |
| InChI | InChI=1S/C26H26BrNO7/c1-26(2,3)35-25(32)28-10-4-5-19(28)24(31)33-14-21(30)16-7-9-18-17-8-6-15(20(29)13-27)11-22(17)34-23(18)12-16/h6-9,11-12,19H,4-5,10,13-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | XRALOBCKNQKDAJ-LJQANCHMSA-N |
| XLogP | 5.29 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|