About 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone
1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone (PubChem CID 91271894) has the molecular formula C11H16N4O2S
and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone |
| PubChem CID | 91271894 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone |
| SMILES | CC(=O)c1nn(C)nc1CSC1=CC(C)(C)ON1 |
| InChI | InChI=1S/C11H16N4O2S/c1-7(16)10-8(12-15(4)13-10)6-18-9-5-11(2,3)17-14-9/h5,14H,6H2,1-4H3 |
| InChIKey | BTVAAMQNQJUYQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone?
The IUPAC name of 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone (CID 91271894) is 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone.
What is the SMILES notation for 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone?
The canonical SMILES for 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone is CC(=O)c1nn(C)nc1CSC1=CC(C)(C)ON1.
What is the InChIKey of 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone?
The InChIKey is BTVAAMQNQJUYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2S/c1-7(16)10-8(12-15(4)13-10)6-18-9-5-11(2,3)17-14-9/h5,14H,6H2,1-4H3.
What are the key properties of 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone?
1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone has a molecular weight of 268.34 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(5,5-dimethyl-2H-1,2-oxazol-3-yl)sulfanylmethyl]-2-methyltriazol-4-yl]ethanone is sourced from PubChem (CID 91271894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).