About (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate
(2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate (PubChem CID 91272276) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate.
Molecular Properties
| Compound Name | (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate |
| PubChem CID | 91272276 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate |
| SMILES | CC[C@@H]1O[C@H](C)CC1O.O |
| InChI | InChI=1S/C7H14O2.H2O/c1-3-7-6(8)4-5(2)9-7;/h5-8H,3-4H2,1-2H3;1H2/t5-,6?,7+;/m1./s1 |
| InChIKey | BKQACHPMZHSHEX-NAZYBQMSSA-N |
| XLogP | 0.11 |
| TPSA | 60.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate?
The IUPAC name of (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate (CID 91272276) is (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate.
What is the SMILES notation for (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate?
The canonical SMILES for (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate is CC[C@@H]1O[C@H](C)CC1O.O.
What is the InChIKey of (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate?
The InChIKey is BKQACHPMZHSHEX-NAZYBQMSSA-N. The full InChI is InChI=1S/C7H14O2.H2O/c1-3-7-6(8)4-5(2)9-7;/h5-8H,3-4H2,1-2H3;1H2/t5-,6?,7+;/m1./s1.
What are the key properties of (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate?
(2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate has a molecular weight of 148.20 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-ethyl-5-methyloxolan-3-ol;hydrate is sourced from PubChem (CID 91272276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).