About (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine
(2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine (PubChem CID 91272391) has the molecular formula C15H24N6S
and a molecular weight of 320.47 g/mol. Its IUPAC name is (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine.
Molecular Properties
| Compound Name | (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine |
| PubChem CID | 91272391 |
| Molecular Formula | C15H24N6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine |
| SMILES | N[C@H](CCN1CCCC1N1NC=NN1)CSc1ccccc1 |
| InChI | InChI=1S/C15H24N6S/c16-13(11-22-14-5-2-1-3-6-14)8-10-20-9-4-7-15(20)21-18-12-17-19-21/h1-3,5-6,12-13,15,19H,4,7-11,16H2,(H,17,18)/t13-,15?/m1/s1 |
| InChIKey | QKHSZBGSIUHKBQ-AFYYWNPRSA-N |
| XLogP | 1.19 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine?
The IUPAC name of (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine (CID 91272391) is (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine.
What is the SMILES notation for (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine?
The canonical SMILES for (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine is N[C@H](CCN1CCCC1N1NC=NN1)CSc1ccccc1.
What is the InChIKey of (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine?
The InChIKey is QKHSZBGSIUHKBQ-AFYYWNPRSA-N. The full InChI is InChI=1S/C15H24N6S/c16-13(11-22-14-5-2-1-3-6-14)8-10-20-9-4-7-15(20)21-18-12-17-19-21/h1-3,5-6,12-13,15,19H,4,7-11,16H2,(H,17,18)/t13-,15?/m1/s1.
What are the key properties of (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine?
(2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine has a molecular weight of 320.47 g/mol, XLogP of 1.19, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[2-(1,3-dihydrotetrazol-2-yl)pyrrolidin-1-yl]-1-phenylsulfanylbutan-2-amine is sourced from PubChem (CID 91272391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).