C13H12N2O4S2 — CID 91272451
3-amino-2-[(4-sulfanylphenyl)sulfonylamino]benzoic acid (PubChem CID 91272451) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-amino-2-[(4-sulfanylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 3-amino-2-[(4-sulfanylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 91272451 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 3-amino-2-[(4-sulfanylphenyl)sulfonylamino]benzoic acid |
| SMILES | Nc1cccc(C(=O)O)c1NS(=O)(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C13H12N2O4S2/c14-11-3-1-2-10(13(16)17)12(11)15-21(18,19)9-6-4-8(20)5-7-9/h1-7,15,20H,14H2,(H,16,17) |
| InChIKey | QOHAJNSPAPUINM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|