C23H24F14O2 — CID 91272553
[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 91272553) has the molecular formula C23H24F14O2 and a molecular weight of 598.42 g/mol. Its IUPAC name is [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 91272553 |
| Molecular Formula | C23H24F14O2 |
| Molecular Weight | 598.42 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyl-4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C21)C(C(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C3 |
| InChI | InChI=1S/C23H24F14O2/c1-8-9(2)12-6-11(8)14-10-5-13(15(12)14)17(7-10,21(29,30)31)16(38)39-4-3-18(24,25)20(27,28)19(26,22(32,33)34)23(35,36)37/h8-15H,3-7H2,1-2H3 |
| InChIKey | FRXKVNCMIYCPTJ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.42 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|