C33H26Cl4N2O5 — CID 91272702
[2-[5,8-dichloro-1-(cyclobutadienyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetyl] 2-(5,8-dichloro-1-cyclopropyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate (PubChem CID 91272702) has the molecular formula C33H26Cl4N2O5 and a molecular weight of 672.39 g/mol. Its IUPAC name is [2-[5,8-dichloro-1-(cyclobutadienyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetyl] 2-(5,8-dichloro-1-cyclopropyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate.
| Compound Name | [2-[5,8-dichloro-1-(cyclobutadienyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetyl] 2-(5,8-dichloro-1-cyclopropyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
|---|---|
| PubChem CID | 91272702 |
| Molecular Formula | C33H26Cl4N2O5 |
| Molecular Weight | 672.39 g/mol |
| Exact Mass | 670.06 |
| IUPAC Name | [2-[5,8-dichloro-1-(cyclobutadienyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetyl] 2-(5,8-dichloro-1-cyclopropyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetate |
| SMILES | O=C(CC1(C2=CC=C2)OCCc2c1[nH]c1c(Cl)ccc(Cl)c21)OC(=O)CC1(C2CC2)OCCc2c1[nH]c1c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C33H26Cl4N2O5/c34-20-6-8-22(36)28-26(20)18-10-12-42-32(30(18)38-28,16-2-1-3-16)14-24(40)44-25(41)15-33(17-4-5-17)31-19(11-13-43-33)27-21(35)7-9-23(37)29(27)39-31/h1-3,6-9,17,38-39H,4-5,10-15H2 |
| InChIKey | JGMNAFAEAGLDNK-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.39 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|