C25H32NO3+ — CID 91272762
N-[2-(3-butan-2-yloxyphenyl)ethyl]-3-(3-cyclopropyl-4-hydroxyphenyl)-2-methylpropanamide (PubChem CID 91272762) has the molecular formula C25H32NO3+ and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[2-(3-butan-2-yloxyphenyl)ethyl]-3-(3-cyclopropyl-4-hydroxyphenyl)-2-methylpropanamide.
| Compound Name | N-[2-(3-butan-2-yloxyphenyl)ethyl]-3-(3-cyclopropyl-4-hydroxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 91272762 |
| Molecular Formula | C25H32NO3+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[2-(3-butan-2-yloxyphenyl)ethyl]-3-(3-cyclopropyl-4-hydroxyphenyl)-2-methylpropanamide |
| SMILES | [CH2+]C(CC)Oc1cccc(CCNC(=O)C(C)Cc2ccc(O)c(C3CC3)c2)c1 |
| InChI | InChI=1S/C25H31NO3/c1-4-18(3)29-22-7-5-6-19(15-22)12-13-26-25(28)17(2)14-20-8-11-24(27)23(16-20)21-9-10-21/h5-8,11,15-18,21H,3-4,9-10,12-14H2,1-2H3,(H-,26,27,28)/p+1 |
| InChIKey | SGYRQNPBBDGANI-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|