C32H49N3O4 — CID 91272841
3-[[1-cyclohexyl-3-(propylamino)propan-2-yl]amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 91272841) has the molecular formula C32H49N3O4 and a molecular weight of 539.76 g/mol. Its IUPAC name is 3-[[1-cyclohexyl-3-(propylamino)propan-2-yl]amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[1-cyclohexyl-3-(propylamino)propan-2-yl]amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 91272841 |
| Molecular Formula | C32H49N3O4 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.37 |
| IUPAC Name | 3-[[1-cyclohexyl-3-(propylamino)propan-2-yl]amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CCCNCC(CC1CCCCC1)Nc1c(N2CCCC(Cc3cccc(OC(CC)OC)c3)C2)c(=O)c1=O |
| InChI | InChI=1S/C32H49N3O4/c1-4-16-33-21-26(19-23-11-7-6-8-12-23)34-29-30(32(37)31(29)36)35-17-10-14-25(22-35)18-24-13-9-15-27(20-24)39-28(5-2)38-3/h9,13,15,20,23,25-26,28,33-34H,4-8,10-12,14,16-19,21-22H2,1-3H3 |
| InChIKey | ICLAKXHIKFENCO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|