About methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate
methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate (PubChem CID 91272886) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate.
Analyze methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate (CID 91272886) is methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate is COC(=O)C1=C(c2ccccc2)NOC1C.
What is the InChIKey of methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate?
The InChIKey is ILXOJNWXVZTZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-8-10(12(14)15-2)11(13-16-8)9-6-4-3-5-7-9/h3-8,13H,1-2H3.
What are the key properties of methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate?
methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate has a molecular weight of 219.24 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 91272886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).