C21H26N8OS — CID 91272996
4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-2-one (PubChem CID 91272996) has the molecular formula C21H26N8OS and a molecular weight of 438.56 g/mol. Its IUPAC name is 4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-2-one.
| Compound Name | 4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 91272996 |
| Molecular Formula | C21H26N8OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-[4-methyl-6-[[5-[(2,4,6-trimethylanilino)methyl]-1,3-thiazol-2-yl]amino]-1,3,5-triazin-2-yl]piperazin-2-one |
| SMILES | Cc1cc(C)c(NCc2cnc(Nc3nc(C)nc(N4CCNC(=O)C4)n3)s2)c(C)c1 |
| InChI | InChI=1S/C21H26N8OS/c1-12-7-13(2)18(14(3)8-12)23-9-16-10-24-21(31-16)28-19-25-15(4)26-20(27-19)29-6-5-22-17(30)11-29/h7-8,10,23H,5-6,9,11H2,1-4H3,(H,22,30)(H,24,25,26,27,28) |
| InChIKey | VBRVFMBCSWCXGX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |