C14H16N2O4S — CID 91273292
carbamoyl 2-(cyclopropanecarbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 91273292) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is carbamoyl 2-(cyclopropanecarbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | carbamoyl 2-(cyclopropanecarbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 91273292 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | carbamoyl 2-(cyclopropanecarbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | NC(=O)OC(=O)c1c(NC(=O)C2CC2)sc2c1CCCC2 |
| InChI | InChI=1S/C14H16N2O4S/c15-14(19)20-13(18)10-8-3-1-2-4-9(8)21-12(10)16-11(17)7-5-6-7/h7H,1-6H2,(H2,15,19)(H,16,17) |
| InChIKey | RDORHTLVHJGIIO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|