C20H18N2O4 — CID 91273298
12-methoxy-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10-pentaene-8-carboxylic acid (PubChem CID 91273298) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 12-methoxy-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10-pentaene-8-carboxylic acid.
| Compound Name | 12-methoxy-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10-pentaene-8-carboxylic acid |
|---|---|
| PubChem CID | 91273298 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 12-methoxy-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10-pentaene-8-carboxylic acid |
| SMILES | COC1(c2ccccc2)C=Cc2c(C(=O)O)cn3c(C)c(C)nc3c2O1 |
| InChI | InChI=1S/C20H18N2O4/c1-12-13(2)22-11-16(19(23)24)15-9-10-20(25-3,14-7-5-4-6-8-14)26-17(15)18(22)21-12/h4-11H,1-3H3,(H,23,24) |
| InChIKey | KKUSGXHUWLDIQE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |