C21H23Cl2FN4 — CID 91273545
5-[(3-cyclopropylpropylamino)methyl]-N-(2,6-dichlorophenyl)-6-fluoro-1-methylbenzimidazol-2-amine (PubChem CID 91273545) has the molecular formula C21H23Cl2FN4 and a molecular weight of 421.35 g/mol. Its IUPAC name is 5-[(3-cyclopropylpropylamino)methyl]-N-(2,6-dichlorophenyl)-6-fluoro-1-methylbenzimidazol-2-amine.
| Compound Name | 5-[(3-cyclopropylpropylamino)methyl]-N-(2,6-dichlorophenyl)-6-fluoro-1-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 91273545 |
| Molecular Formula | C21H23Cl2FN4 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 5-[(3-cyclopropylpropylamino)methyl]-N-(2,6-dichlorophenyl)-6-fluoro-1-methylbenzimidazol-2-amine |
| SMILES | Cn1c(Nc2c(Cl)cccc2Cl)nc2cc(CNCCCC3CC3)c(F)cc21 |
| InChI | InChI=1S/C21H23Cl2FN4/c1-28-19-11-17(24)14(12-25-9-3-4-13-7-8-13)10-18(19)26-21(28)27-20-15(22)5-2-6-16(20)23/h2,5-6,10-11,13,25H,3-4,7-9,12H2,1H3,(H,26,27) |
| InChIKey | WPFAAFXPGJEUGC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|