About hexa-1,4,5-trien-3-one
hexa-1,4,5-trien-3-one (PubChem CID 91274261) has the molecular formula C6H6O
and a molecular weight of 94.11 g/mol. Its IUPAC name is hexa-1,4,5-trien-3-one.
Molecular Properties
| Compound Name | hexa-1,4,5-trien-3-one |
| PubChem CID | 91274261 |
| Molecular Formula | C6H6O |
| Molecular Weight | 94.11 g/mol |
| Exact Mass | 94.04 |
| IUPAC Name | hexa-1,4,5-trien-3-one |
| SMILES | C=C=CC(=O)C=C |
| InChI | InChI=1S/C6H6O/c1-3-5-6(7)4-2/h4-5H,1-2H2 |
| InChIKey | FHUQQSGDTLEOMO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.11 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hexa-1,4,5-trien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,4,5-trien-3-one?
The IUPAC name of hexa-1,4,5-trien-3-one (CID 91274261) is hexa-1,4,5-trien-3-one.
What is the SMILES notation for hexa-1,4,5-trien-3-one?
The canonical SMILES for hexa-1,4,5-trien-3-one is C=C=CC(=O)C=C.
What is the InChIKey of hexa-1,4,5-trien-3-one?
The InChIKey is FHUQQSGDTLEOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O/c1-3-5-6(7)4-2/h4-5H,1-2H2.
What are the key properties of hexa-1,4,5-trien-3-one?
hexa-1,4,5-trien-3-one has a molecular weight of 94.11 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,4,5-trien-3-one is sourced from PubChem (CID 91274261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).