C23H28N4O3S — CID 91274374
2-tert-butyl-1,1-dioxo-5-phenyl-4-(1-pyridin-2-ylpiperidin-4-yl)imino-1,2-thiazolidin-3-one (PubChem CID 91274374) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-tert-butyl-1,1-dioxo-5-phenyl-4-(1-pyridin-2-ylpiperidin-4-yl)imino-1,2-thiazolidin-3-one.
| Compound Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-(1-pyridin-2-ylpiperidin-4-yl)imino-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 91274374 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-tert-butyl-1,1-dioxo-5-phenyl-4-(1-pyridin-2-ylpiperidin-4-yl)imino-1,2-thiazolidin-3-one |
| SMILES | CC(C)(C)N1C(=O)/C(=N\C2CCN(c3ccccn3)CC2)C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C23H28N4O3S/c1-23(2,3)27-22(28)20(21(31(27,29)30)17-9-5-4-6-10-17)25-18-12-15-26(16-13-18)19-11-7-8-14-24-19/h4-11,14,18,21H,12-13,15-16H2,1-3H3/b25-20- |
| InChIKey | OGCLTSATVDIONG-QQTULTPQSA-N |
| XLogP | 3.20 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|