C12H11N3O2 — CID 91274594
6-nitro-1,2,3,4-tetrahydrobenzo[f]quinoxaline (PubChem CID 91274594) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 6-nitro-1,2,3,4-tetrahydrobenzo[f]quinoxaline.
| Compound Name | 6-nitro-1,2,3,4-tetrahydrobenzo[f]quinoxaline |
|---|---|
| PubChem CID | 91274594 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 6-nitro-1,2,3,4-tetrahydrobenzo[f]quinoxaline |
| SMILES | O=[N+]([O-])c1cc2c(c3ccccc13)NCCN2 |
| InChI | InChI=1S/C12H11N3O2/c16-15(17)11-7-10-12(14-6-5-13-10)9-4-2-1-3-8(9)11/h1-4,7,13-14H,5-6H2 |
| InChIKey | GYJWLYCTOWTHKC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|