C26H40O3 — CID 91274644
4-butan-2-ylphenol;(2-methyl-2-adamantyl) 2-methylbutanoate (PubChem CID 91274644) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 4-butan-2-ylphenol;(2-methyl-2-adamantyl) 2-methylbutanoate.
| Compound Name | 4-butan-2-ylphenol;(2-methyl-2-adamantyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 91274644 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 4-butan-2-ylphenol;(2-methyl-2-adamantyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H26O2.C10H14O/c1-4-10(2)15(17)18-16(3)13-6-11-5-12(8-13)9-14(16)7-11;1-3-8(2)9-4-6-10(11)7-5-9/h10-14H,4-9H2,1-3H3;4-8,11H,3H2,1-2H3 |
| InChIKey | ZNBVVBFQJCDXMI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |