C29H29F4N3O2S — CID 91275005
tert-butyl N-[1-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-[4-(trifluoromethyl)phenyl]pentan-3-yl]carbamate (PubChem CID 91275005) has the molecular formula C29H29F4N3O2S and a molecular weight of 559.63 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-[4-(trifluoromethyl)phenyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-[4-(trifluoromethyl)phenyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 91275005 |
| Molecular Formula | C29H29F4N3O2S |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | tert-butyl N-[1-[5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-yl]-4-[4-(trifluoromethyl)phenyl]pentan-3-yl]carbamate |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)C(CCc1ncc(-c2ccc3cnc(F)cc3c2)s1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H29F4N3O2S/c1-17(18-7-9-22(10-8-18)29(31,32)33)23(36-27(37)38-28(2,3)4)11-12-26-35-16-24(39-26)19-5-6-20-15-34-25(30)14-21(20)13-19/h5-10,13-17,23H,11-12H2,1-4H3,(H,36,37) |
| InChIKey | FBBZOGJMONJJEQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|