About 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol
3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol (PubChem CID 91275028) has the molecular formula C18H15FN2O
and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol.
Molecular Properties
| Compound Name | 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol |
| PubChem CID | 91275028 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol |
| SMILES | OC1CCn2c1cnc2-c1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H15FN2O/c19-15-6-4-12(5-7-15)13-2-1-3-14(10-13)18-20-11-16-17(22)8-9-21(16)18/h1-7,10-11,17,22H,8-9H2 |
| InChIKey | BPCIVBIZXWXJFS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol?
The IUPAC name of 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol (CID 91275028) is 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol.
What is the SMILES notation for 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol?
The canonical SMILES for 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol is OC1CCn2c1cnc2-c1cccc(-c2ccc(F)cc2)c1.
What is the InChIKey of 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol?
The InChIKey is BPCIVBIZXWXJFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O/c19-15-6-4-12(5-7-15)13-2-1-3-14(10-13)18-20-11-16-17(22)8-9-21(16)18/h1-7,10-11,17,22H,8-9H2.
What are the key properties of 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol?
3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol has a molecular weight of 294.33 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-fluorophenyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-ol is sourced from PubChem (CID 91275028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).