C30H32N3O6S+ — CID 91275220
2-[(3-ethyl-6-nitro-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-[[1-[2-(2-methoxyethoxy)ethyl]-3,3-dimethyl-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione (PubChem CID 91275220) has the molecular formula C30H32N3O6S+ and a molecular weight of 562.67 g/mol. Its IUPAC name is 2-[(3-ethyl-6-nitro-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-[[1-[2-(2-methoxyethoxy)ethyl]-3,3-dimethyl-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione.
| Compound Name | 2-[(3-ethyl-6-nitro-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-[[1-[2-(2-methoxyethoxy)ethyl]-3,3-dimethyl-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 91275220 |
| Molecular Formula | C30H32N3O6S+ |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 2-[(3-ethyl-6-nitro-1,3-benzothiazol-3-ium-2-yl)methylidene]-4-[[1-[2-(2-methoxyethoxy)ethyl]-3,3-dimethyl-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione |
| SMILES | CC[n+]1c(C=c2c(=O)c(=CC3N(CCOCCOC)c4ccccc4C3(C)C)c2=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C30H32N3O6S/c1-5-31-24-11-10-19(33(36)37)16-25(24)40-27(31)18-21-28(34)20(29(21)35)17-26-30(2,3)22-8-6-7-9-23(22)32(26)12-13-39-15-14-38-4/h6-11,16-18,26H,5,12-15H2,1-4H3/q+1/b20-17-,21-18+ |
| InChIKey | BFSDHHKYUQTZLE-WPDZNWIASA-N |
| XLogP | 2.15 |
| TPSA | 102.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|