C22H30F2N4O2S — CID 91275313
N-[5-[1-(butylamino)ethyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide (PubChem CID 91275313) has the molecular formula C22H30F2N4O2S and a molecular weight of 452.57 g/mol. Its IUPAC name is N-[5-[1-(butylamino)ethyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide.
| Compound Name | N-[5-[1-(butylamino)ethyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 91275313 |
| Molecular Formula | C22H30F2N4O2S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[5-[1-(butylamino)ethyl]-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
| SMILES | CCCCNC(C)c1cnc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)s1 |
| InChI | InChI=1S/C22H30F2N4O2S/c1-4-6-8-25-14(3)19-13-26-22(31-19)28-21(30)18(7-5-2)27-20(29)11-15-9-16(23)12-17(24)10-15/h9-10,12-14,18,25H,4-8,11H2,1-3H3,(H,27,29)(H,26,28,30) |
| InChIKey | IYODMMGZTGSKGN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|