C10H18O9 — CID 91275479
(3S,4S)-1,4,5-trihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentan-2-one (PubChem CID 91275479) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is (3S,4S)-1,4,5-trihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentan-2-one.
| Compound Name | (3S,4S)-1,4,5-trihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentan-2-one |
|---|---|
| PubChem CID | 91275479 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (3S,4S)-1,4,5-trihydroxy-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentan-2-one |
| SMILES | O=C(CO)[C@@H](O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)[C@@H](O)CO |
| InChI | InChI=1S/C10H18O9/c11-1-4(13)9(5(14)2-12)19-10-8(17)7(16)6(15)3-18-10/h4,6-13,15-17H,1-3H2/t4-,6+,7-,8+,9-,10-/m0/s1 |
| InChIKey | TXHDINWQPJGNGC-MNVHZIEBSA-N |
| XLogP | -4.27 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |