C13H13N — CID 91276767
trideca-2,4,5,7,9,11,12-heptaen-1-imine (PubChem CID 91276767) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is trideca-2,4,5,7,9,11,12-heptaen-1-imine.
| Compound Name | trideca-2,4,5,7,9,11,12-heptaen-1-imine |
|---|---|
| PubChem CID | 91276767 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | trideca-2,4,5,7,9,11,12-heptaen-1-imine |
| SMILES | [H]/N=C/C=CC=C=CC=CC=CC=C=C |
| InChI | InChI=1S/C13H13N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14/h3-8,10-14H,1H2/b5-4?,7-6?,12-11?,14-13+ |
| InChIKey | UYNATCVOSQKNDW-SSKHRFKKSA-N |
| XLogP | 3.36 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|