C52H25F12N7 — CID 91277025
5,10,15-tris(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,22,23,24-tetrahydro-7H-corrin (PubChem CID 91277025) has the molecular formula C52H25F12N7 and a molecular weight of 975.80 g/mol. Its IUPAC name is 5,10,15-tris(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,22,23,24-tetrahydro-7H-corrin.
| Compound Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,22,23,24-tetrahydro-7H-corrin |
|---|---|
| PubChem CID | 91277025 |
| Molecular Formula | C52H25F12N7 |
| Molecular Weight | 975.80 g/mol |
| Exact Mass | 975.20 |
| IUPAC Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-21,22,23,24-tetrahydro-7H-corrin |
| SMILES | Fc1c(F)c(-c2ccccn2)c(F)c(F)c1C1=C2CC=C(N2)C(c2c(F)c(F)c(-c3ccccn3)c(F)c2F)=c2ccc([nH]2)=C(c2c(F)c(F)c(-c3ccccn3)c(F)c2F)c2ccc([nH]2)-c2ccc1[nH]2 |
| InChI | InChI=1S/C52H25F12N7/c53-41-35(23-7-1-4-18-65-23)42(54)48(60)38(47(41)59)32-26-12-10-21(68-26)22-11-13-27(69-22)33(39-49(61)43(55)36(44(56)50(39)62)24-8-2-5-19-66-24)29-15-17-31(71-29)34(30-16-14-28(32)70-30)40-51(63)45(57)37(46(58)52(40)64)25-9-3-6-20-67-25/h1-14,16-20,68-71H,15H2 |
| InChIKey | CSOVSGVBPOBPGX-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.80 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|