C28H31N5O9 — CID 91277191
ethyl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]-1H-imidazole-5-carboxylate (PubChem CID 91277191) has the molecular formula C28H31N5O9 and a molecular weight of 581.58 g/mol. Its IUPAC name is ethyl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 91277191 |
| Molecular Formula | C28H31N5O9 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | ethyl 2-[[(5aR,6aS,10aS)-9-carbamoyl-4-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methylamino]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCc2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C[C@@H]4C[C@@H]2C3)[nH]1 |
| InChI | InChI=1S/C28H31N5O9/c1-4-42-26(40)15-10-31-27(32-15)30-9-12-7-16(33(2)3)14-6-11-5-13-8-17(34)20(25(29)39)24(38)28(13,41)23(37)18(11)22(36)19(14)21(12)35/h7,10-11,13,18,20,35,41H,4-6,8-9H2,1-3H3,(H2,29,39)(H2,30,31,32)/t11-,13+,18?,20?,28+/m1/s1 |
| InChIKey | XHSWWYWDOSQOFY-IOIMHGTESA-N |
| XLogP | -0.10 |
| TPSA | 222.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|