About 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium
3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium (PubChem CID 91277205) has the molecular formula C5H11N2O+
and a molecular weight of 115.16 g/mol. Its IUPAC name is 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 91277205 |
| Molecular Formula | C5H11N2O+ |
| Molecular Weight | 115.16 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium |
| SMILES | CC1C[N+](C)=CN1O |
| InChI | InChI=1S/C5H11N2O/c1-5-3-6(2)4-7(5)8/h4-5,8H,3H2,1-2H3/q+1 |
| InChIKey | NLSCVINDOCRPNM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium (CID 91277205) is 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium is CC1C[N+](C)=CN1O.
What is the InChIKey of 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium?
The InChIKey is NLSCVINDOCRPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2O/c1-5-3-6(2)4-7(5)8/h4-5,8H,3H2,1-2H3/q+1.
What are the key properties of 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium?
3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium has a molecular weight of 115.16 g/mol, XLogP of -0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,4-dimethyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 91277205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).