About 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline
2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline (PubChem CID 91277240) has the molecular formula C36H45N3
and a molecular weight of 519.78 g/mol. Its IUPAC name is 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline |
| PubChem CID | 91277240 |
| Molecular Formula | C36H45N3 |
| Molecular Weight | 519.78 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline |
| SMILES | CCCCCC(C)(C)c1ccc(N(c2ccccc2)c2ccccc2)c(-c2ccc(C(N)(CC)CC)nc2)c1 |
| InChI | InChI=1S/C36H45N3/c1-6-9-16-25-35(4,5)29-22-23-33(39(30-17-12-10-13-18-30)31-19-14-11-15-20-31)32(26-29)28-21-24-34(38-27-28)36(37,7-2)8-3/h10-15,17-24,26-27H,6-9,16,25,37H2,1-5H3 |
| InChIKey | OIUUIADTPRDRDS-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.78 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline?
The IUPAC name of 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline (CID 91277240) is 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline.
What is the SMILES notation for 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline?
The canonical SMILES for 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline is CCCCCC(C)(C)c1ccc(N(c2ccccc2)c2ccccc2)c(-c2ccc(C(N)(CC)CC)nc2)c1.
What is the InChIKey of 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline?
The InChIKey is OIUUIADTPRDRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H45N3/c1-6-9-16-25-35(4,5)29-22-23-33(39(30-17-12-10-13-18-30)31-19-14-11-15-20-31)32(26-29)28-21-24-34(38-27-28)36(37,7-2)8-3/h10-15,17-24,26-27H,6-9,16,25,37H2,1-5H3.
What are the key properties of 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline?
2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline has a molecular weight of 519.78 g/mol, XLogP of 10.05, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3-aminopentan-3-yl)-3-pyridinyl]-4-(2-methylheptan-2-yl)-N,N-diphenylaniline is sourced from PubChem (CID 91277240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).