C26H36O3 — CID 91277290
5-[(1S,2R,3R)-3-(methoxymethyl)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylpenta-2,4-dienoic acid (PubChem CID 91277290) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 5-[(1S,2R,3R)-3-(methoxymethyl)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[(1S,2R,3R)-3-(methoxymethyl)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91277290 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 5-[(1S,2R,3R)-3-(methoxymethyl)-2-methyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)cyclopropyl]-3-methylpenta-2,4-dienoic acid |
| SMILES | COC[C@@H]1[C@H](C=CC(C)=CC(=O)O)[C@@]1(C)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H36O3/c1-17(14-23(27)28)8-10-20-22(16-29-7)26(20,6)18-9-11-19-21(15-18)25(4,5)13-12-24(19,2)3/h8-11,14-15,20,22H,12-13,16H2,1-7H3,(H,27,28)/t20-,22+,26+/m0/s1 |
| InChIKey | LLPALHYEEHKOOI-UNIVCBNLSA-N |
| XLogP | 5.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|