C24H26ClN3 — CID 91277294
(1S,11R)-9-[2-(6-chloro-3-pyridinyl)ethyl]-5-methyl-9,13-diazapentacyclo[11.3.1.111,15.02,10.03,8]octadeca-2(10),3(8),4,6-tetraene (PubChem CID 91277294) has the molecular formula C24H26ClN3 and a molecular weight of 391.95 g/mol. Its IUPAC name is (1S,11R)-9-[2-(6-chloro-3-pyridinyl)ethyl]-5-methyl-9,13-diazapentacyclo[11.3.1.111,15.02,10.03,8]octadeca-2(10),3(8),4,6-tetraene.
| Compound Name | (1S,11R)-9-[2-(6-chloro-3-pyridinyl)ethyl]-5-methyl-9,13-diazapentacyclo[11.3.1.111,15.02,10.03,8]octadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 91277294 |
| Molecular Formula | C24H26ClN3 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (1S,11R)-9-[2-(6-chloro-3-pyridinyl)ethyl]-5-methyl-9,13-diazapentacyclo[11.3.1.111,15.02,10.03,8]octadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(Cl)nc2)[C@@H]2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C24H26ClN3/c1-15-2-4-21-20(8-15)23-18-9-17-10-19(14-27(12-17)13-18)24(23)28(21)7-6-16-3-5-22(25)26-11-16/h2-5,8,11,17-19H,6-7,9-10,12-14H2,1H3/t17?,18?,19-/m1/s1 |
| InChIKey | IIZXXHLPCMWMKK-CTWPCTMYSA-N |
| XLogP | 5.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|