About ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine
ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine (PubChem CID 91277980) has the molecular formula C21H29NS
and a molecular weight of 327.54 g/mol. Its IUPAC name is ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine.
Molecular Properties
| Compound Name | ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine |
| PubChem CID | 91277980 |
| Molecular Formula | C21H29NS |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine |
| SMILES | CC.CC.NCC1=CCCc2cc(Sc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H17NS.2C2H6/c18-12-14-6-4-5-13-11-16(9-10-17(13)14)19-15-7-2-1-3-8-15;2*1-2/h1-3,6-11H,4-5,12,18H2;2*1-2H3 |
| InChIKey | RXBOXISFFMBSNS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine?
The IUPAC name of ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine (CID 91277980) is ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine.
What is the SMILES notation for ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine?
The canonical SMILES for ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine is CC.CC.NCC1=CCCc2cc(Sc3ccccc3)ccc21.
What is the InChIKey of ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine?
The InChIKey is RXBOXISFFMBSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NS.2C2H6/c18-12-14-6-4-5-13-11-16(9-10-17(13)14)19-15-7-2-1-3-8-15;2*1-2/h1-3,6-11H,4-5,12,18H2;2*1-2H3.
What are the key properties of ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine?
ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine has a molecular weight of 327.54 g/mol, XLogP of 6.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(6-phenylsulfanyl-3,4-dihydronaphthalen-1-yl)methanamine is sourced from PubChem (CID 91277980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).