C27H26F3N3O2 — CID 91278130
N-[2-[3-(2-cyclopentyloxy-3-methoxyphenyl)prop-2-enylideneamino]phenyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 91278130) has the molecular formula C27H26F3N3O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is N-[2-[3-(2-cyclopentyloxy-3-methoxyphenyl)prop-2-enylideneamino]phenyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-[3-(2-cyclopentyloxy-3-methoxyphenyl)prop-2-enylideneamino]phenyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 91278130 |
| Molecular Formula | C27H26F3N3O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[2-[3-(2-cyclopentyloxy-3-methoxyphenyl)prop-2-enylideneamino]phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1cccc(C=C/C=N/c2ccccc2Nc2ccc(C(F)(F)F)cn2)c1OC1CCCC1 |
| InChI | InChI=1S/C27H26F3N3O2/c1-34-24-14-6-8-19(26(24)35-21-10-2-3-11-21)9-7-17-31-22-12-4-5-13-23(22)33-25-16-15-20(18-32-25)27(28,29)30/h4-9,12-18,21H,2-3,10-11H2,1H3,(H,32,33)/b9-7?,31-17+ |
| InChIKey | NFVZSFYFLJWXRH-YEDXFXQBSA-N |
| XLogP | 7.59 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|