C70H89N3O12 — CID 91278132
CID 91278132 (PubChem CID 91278132) has the molecular formula C70H89N3O12 and a molecular weight of 1164.49 g/mol.
| Compound Name | CID 91278132 |
|---|---|
| PubChem CID | 91278132 |
| Molecular Formula | C70H89N3O12 |
| Molecular Weight | 1164.49 g/mol |
| Exact Mass | 1163.64 |
| IUPAC Name | — |
| SMILES | CC/C=C\COc1ccc(-n2ncc3c2C=C2[C@@H](C)C[C@@H]4[C@H]([C@@H](O)C[C@@]5(C)[C@H]4CC[C@@]54OCOC45COCO5)[C@@]2(C)C3)cc1.CCOc1ccc(-n2cc3c(c2)C[C@@]2(C)C(=C3)[C@@H](C)C[C@@H]3[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]3CC[C@@]23OCOC32COCO2)cc1 |
| InChI | InChI=1S/C36H46N2O6.C34H43NO6/c1-5-6-7-14-41-26-10-8-25(9-11-26)38-30-16-29-23(2)15-27-28-12-13-35(36(44-22-42-35)20-40-21-43-36)34(28,4)18-31(39)32(27)33(29,3)17-24(30)19-37-38;1-5-38-25-8-6-24(7-9-25)35-16-22-13-28-21(2)12-26-27-10-11-33(34(41-20-39-33)18-37-19-40-34)32(27,4)15-29(36)30(26)31(28,3)14-23(22)17-35/h6-11,16,19,23,27-28,31-32,39H,5,12-15,17-18,20-22H2,1-4H3;6-9,13,16-17,21,26-27,29-30,36H,5,10-12,14-15,18-20H2,1-4H3/b7-6-;/t23-,27-,28-,31-,32+,33-,34-,35+,36?;21-,26-,27-,29-,30+,31-,32-,33+,34?/m00/s1 |
| InChIKey | NYBGZUKRHOPUFH-BGRIUIIZSA-N |
| XLogP | 11.78 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.49 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|