About [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate (PubChem CID 9127823) has the molecular formula C21H25FO4
and a molecular weight of 360.43 g/mol. Its IUPAC name is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate.
Molecular Properties
| Compound Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
| PubChem CID | 9127823 |
| Molecular Formula | C21H25FO4 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate |
| SMILES | C[C@H](OC(=O)CC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FO4/c1-13(19(24)16-2-4-17(22)5-3-16)26-18(23)11-20-7-14-6-15(8-20)10-21(25,9-14)12-20/h2-5,13-15,25H,6-12H2,1H3/t13-,14-,15+,20?,21?/m0/s1 |
| InChIKey | KCQMJUDCJBIGJP-MYUHQCNJSA-N |
| XLogP | 3.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate?
The IUPAC name of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate (CID 9127823) is [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate.
What is the SMILES notation for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate?
The canonical SMILES for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate is C[C@H](OC(=O)CC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)C(=O)c1ccc(F)cc1.
What is the InChIKey of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate?
The InChIKey is KCQMJUDCJBIGJP-MYUHQCNJSA-N. The full InChI is InChI=1S/C21H25FO4/c1-13(19(24)16-2-4-17(22)5-3-16)26-18(23)11-20-7-14-6-15(8-20)10-21(25,9-14)12-20/h2-5,13-15,25H,6-12H2,1H3/t13-,14-,15+,20?,21?/m0/s1.
What are the key properties of [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate?
[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate has a molecular weight of 360.43 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl] 2-[(5S,7R)-3-hydroxy-1-adamantyl]acetate is sourced from PubChem (CID 9127823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).