About 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole
2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole (PubChem CID 91278345) has the molecular formula C12H7F3N4S2
and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole |
| PubChem CID | 91278345 |
| Molecular Formula | C12H7F3N4S2 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole |
| SMILES | Cc1cnc(-c2ccnc(-c3nc(C(F)(F)F)cs3)n2)s1 |
| InChI | InChI=1S/C12H7F3N4S2/c1-6-4-17-10(21-6)7-2-3-16-9(18-7)11-19-8(5-20-11)12(13,14)15/h2-5H,1H3 |
| InChIKey | OLYBBPXNIPGWKU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole?
The IUPAC name of 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole (CID 91278345) is 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole.
What is the SMILES notation for 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole?
The canonical SMILES for 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole is Cc1cnc(-c2ccnc(-c3nc(C(F)(F)F)cs3)n2)s1.
What is the InChIKey of 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole?
The InChIKey is OLYBBPXNIPGWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3N4S2/c1-6-4-17-10(21-6)7-2-3-16-9(18-7)11-19-8(5-20-11)12(13,14)15/h2-5H,1H3.
What are the key properties of 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole?
2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole has a molecular weight of 328.34 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-methyl-1,3-thiazol-2-yl)pyrimidin-2-yl]-4-(trifluoromethyl)-1,3-thiazole is sourced from PubChem (CID 91278345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).