C22H27N3 — CID 91278373
(1S,2S,10R,11S)-5,12-dimethyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,12-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene (PubChem CID 91278373) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is (1S,2S,10R,11S)-5,12-dimethyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,12-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene.
| Compound Name | (1S,2S,10R,11S)-5,12-dimethyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,12-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 91278373 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (1S,2S,10R,11S)-5,12-dimethyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-9,12-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-3(8),4,6-triene |
| SMILES | Cc1ccc2c(c1)[C@@H]1[C@@H]3C[C@@H]([C@@H]1N2CCc1ccc(C)nc1)N(C)C3 |
| InChI | InChI=1S/C22H27N3/c1-14-4-7-19-18(10-14)21-17-11-20(24(3)13-17)22(21)25(19)9-8-16-6-5-15(2)23-12-16/h4-7,10,12,17,20-22H,8-9,11,13H2,1-3H3/t17-,20+,21+,22+/m1/s1 |
| InChIKey | YTAHNPNMFPSDDS-MNAPGUCWSA-N |
| XLogP | 3.55 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |