C19H18N2O2 — CID 91278846
2-[4-[(1S,7R,8R,10S)-3,5-dihydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-dien-4-yl]phenyl]acetonitrile (PubChem CID 91278846) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[4-[(1S,7R,8R,10S)-3,5-dihydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-dien-4-yl]phenyl]acetonitrile.
| Compound Name | 2-[4-[(1S,7R,8R,10S)-3,5-dihydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-dien-4-yl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 91278846 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[4-[(1S,7R,8R,10S)-3,5-dihydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-dien-4-yl]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(-n2c(O)c3c(c2O)[C@@H]2CC[C@H]3[C@H]3C[C@H]32)cc1 |
| InChI | InChI=1S/C19H18N2O2/c20-8-7-10-1-3-11(4-2-10)21-18(22)16-12-5-6-13(15-9-14(12)15)17(16)19(21)23/h1-4,12-15,22-23H,5-7,9H2/t12-,13+,14+,15- |
| InChIKey | ZLLCNMVNFJIRCT-PYHGIMPFSA-N |
| XLogP | 3.57 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |