C26H40O6 — CID 91279475
7,15-dihydroxy-19-(1-hydroxyethyl)-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione;ethane (PubChem CID 91279475) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 7,15-dihydroxy-19-(1-hydroxyethyl)-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione;ethane.
| Compound Name | 7,15-dihydroxy-19-(1-hydroxyethyl)-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione;ethane |
|---|---|
| PubChem CID | 91279475 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 7,15-dihydroxy-19-(1-hydroxyethyl)-14-methyl-20-oxatetracyclo[10.10.0.02,10.05,9]docosa-3,11-diene-13,21-dione;ethane |
| SMILES | CC.CC(O)C1CCCC(O)C(C)C(=O)C2=CC3C(C=CC4CC(O)CC43)C2CC(=O)O1 |
| InChI | InChI=1S/C24H34O6.C2H6/c1-12-21(27)4-3-5-22(13(2)25)30-23(28)11-19-16-7-6-14-8-15(26)9-17(14)18(16)10-20(19)24(12)29;1-2/h6-7,10,12-19,21-22,25-27H,3-5,8-9,11H2,1-2H3;1-2H3 |
| InChIKey | REEZGPUAKGSYSS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|