C21H24N6O2 — CID 91279611
N-methyl-3-[2-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]but-2-enamide (PubChem CID 91279611) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-methyl-3-[2-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]but-2-enamide.
| Compound Name | N-methyl-3-[2-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 91279611 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-methyl-3-[2-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]phenyl]but-2-enamide |
| SMILES | CNC(=O)C=C(C)c1ccccc1OCC1CCCN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C21H24N6O2/c1-14(10-18(28)22-2)16-7-3-4-8-17(16)29-11-15-6-5-9-27(15)21-19-20(24-12-23-19)25-13-26-21/h3-4,7-8,10,12-13,15H,5-6,9,11H2,1-2H3,(H,22,28)(H,23,24,25,26) |
| InChIKey | ZEMNVZNSDPQDAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|