C19H34O6Si2 — CID 91279706
acetic acid;bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate (PubChem CID 91279706) has the molecular formula C19H34O6Si2 and a molecular weight of 414.65 g/mol. Its IUPAC name is acetic acid;bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate.
| Compound Name | acetic acid;bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91279706 |
| Molecular Formula | C19H34O6Si2 |
| Molecular Weight | 414.65 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | acetic acid;bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate |
| SMILES | C=CC1CC(C=C)C(C(=O)O[Si](C)(C)C)C1C(=O)O[Si](C)(C)C.CC(=O)O |
| InChI | InChI=1S/C17H30O4Si2.C2H4O2/c1-9-12-11-13(10-2)15(17(19)21-23(6,7)8)14(12)16(18)20-22(3,4)5;1-2(3)4/h9-10,12-15H,1-2,11H2,3-8H3;1H3,(H,3,4) |
| InChIKey | VKNBSPTYQJSWKA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|