C23H22N4O4 — CID 91279752
10-[8-(2-methylpropyl)-2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl]-1,3,4,10b-tetrahydropyrido[1,2-b]isoindole-2,6-dione (PubChem CID 91279752) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 10-[8-(2-methylpropyl)-2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl]-1,3,4,10b-tetrahydropyrido[1,2-b]isoindole-2,6-dione.
| Compound Name | 10-[8-(2-methylpropyl)-2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl]-1,3,4,10b-tetrahydropyrido[1,2-b]isoindole-2,6-dione |
|---|---|
| PubChem CID | 91279752 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 10-[8-(2-methylpropyl)-2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl]-1,3,4,10b-tetrahydropyrido[1,2-b]isoindole-2,6-dione |
| SMILES | CC(C)Cc1nccc2c(=O)n(-c3cccc4c3C3CC(=O)CCN3C4=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C23H22N4O4/c1-12(2)10-16-20-15(6-8-24-16)22(30)27(23(31)25-20)17-5-3-4-14-19(17)18-11-13(28)7-9-26(18)21(14)29/h3-6,8,12,18H,7,9-11H2,1-2H3,(H,25,31) |
| InChIKey | GLJVESYQYJWNKF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |