C12H11N5O2S — CID 9127990
N-(furan-2-ylmethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide (PubChem CID 9127990) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9127990 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(5-thiophen-3-yltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccsc2)n1)NCc1ccco1 |
| InChI | InChI=1S/C12H11N5O2S/c18-11(13-6-10-2-1-4-19-10)7-17-15-12(14-16-17)9-3-5-20-8-9/h1-5,8H,6-7H2,(H,13,18) |
| InChIKey | WVBJPEGDUKJPPX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |