C27H46O — CID 91280045
(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-ol (PubChem CID 91280045) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-ol.
| Compound Name | (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-ol |
|---|---|
| PubChem CID | 91280045 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C(O)CCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H46O/c1-18(2)8-6-9-19(3)21-13-14-22-20-11-12-24-25(28)10-7-16-26(24,4)23(20)15-17-27(21,22)5/h12,18-23,25,28H,6-11,13-17H2,1-5H3/t19-,20?,21-,22?,23?,25?,26-,27-/m1/s1 |
| InChIKey | IYDDNBNPULHLAU-CZYNSGSISA-N |
| XLogP | 7.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|