C17H21NO8 — CID 91281146
4-methoxy-1-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyquinolin-2-one (PubChem CID 91281146) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is 4-methoxy-1-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyquinolin-2-one.
| Compound Name | 4-methoxy-1-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyquinolin-2-one |
|---|---|
| PubChem CID | 91281146 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-methoxy-1-methyl-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyquinolin-2-one |
| SMILES | COc1cc(=O)n(C)c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc12 |
| InChI | InChI=1S/C17H21NO8/c1-18-12(20)6-10(24-2)8-4-3-5-9(13(8)18)25-17-16(23)15(22)14(21)11(7-19)26-17/h3-6,11,14-17,19,21-23H,7H2,1-2H3/t11-,14-,15+,16-,17-/m1/s1 |
| InChIKey | WYKZUPBZITULHB-ZQOQDGPXSA-N |
| XLogP | -1.27 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |