About (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium
(7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium (PubChem CID 91281329) has the molecular formula C17H30N+
and a molecular weight of 248.43 g/mol. Its IUPAC name is (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium.
Molecular Properties
| Compound Name | (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium |
| PubChem CID | 91281329 |
| Molecular Formula | C17H30N+ |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.24 |
| IUPAC Name | (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium |
| SMILES | CC#CC(CC)=C(C)CCC=C(C)C[N+](C)(C)C |
| InChI | InChI=1S/C17H30N/c1-8-11-17(9-2)16(4)13-10-12-15(3)14-18(5,6)7/h12H,9-10,13-14H2,1-7H3/q+1 |
| InChIKey | BCMPXTVNGXDLFZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium?
The IUPAC name of (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium (CID 91281329) is (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium.
What is the SMILES notation for (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium?
The canonical SMILES for (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium is CC#CC(CC)=C(C)CCC=C(C)C[N+](C)(C)C.
What is the InChIKey of (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium?
The InChIKey is BCMPXTVNGXDLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N/c1-8-11-17(9-2)16(4)13-10-12-15(3)14-18(5,6)7/h12H,9-10,13-14H2,1-7H3/q+1.
What are the key properties of (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium?
(7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium has a molecular weight of 248.43 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (7-ethyl-2,6-dimethyldeca-2,6-dien-8-ynyl)-trimethylazanium is sourced from PubChem (CID 91281329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).