About 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine
1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine (PubChem CID 91281349) has the molecular formula C17H17F2NO3S
and a molecular weight of 353.39 g/mol. Its IUPAC name is 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine.
Molecular Properties
| Compound Name | 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine |
| PubChem CID | 91281349 |
| Molecular Formula | C17H17F2NO3S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine |
| SMILES | O=S(=O)(c1cccc(Oc2ccc(F)cc2F)c1)N1CCCCC1 |
| InChI | InChI=1S/C17H17F2NO3S/c18-13-7-8-17(16(19)11-13)23-14-5-4-6-15(12-14)24(21,22)20-9-2-1-3-10-20/h4-8,11-12H,1-3,9-10H2 |
| InChIKey | CAXLUTBTDRWDNH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine?
The IUPAC name of 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine (CID 91281349) is 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine.
What is the SMILES notation for 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine?
The canonical SMILES for 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine is O=S(=O)(c1cccc(Oc2ccc(F)cc2F)c1)N1CCCCC1.
What is the InChIKey of 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine?
The InChIKey is CAXLUTBTDRWDNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO3S/c18-13-7-8-17(16(19)11-13)23-14-5-4-6-15(12-14)24(21,22)20-9-2-1-3-10-20/h4-8,11-12H,1-3,9-10H2.
What are the key properties of 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine?
1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine has a molecular weight of 353.39 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,4-difluorophenoxy)phenyl]sulfonylpiperidine is sourced from PubChem (CID 91281349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).