About 3,3-difluoropyrrole
3,3-difluoropyrrole (PubChem CID 91281361) has the molecular formula C4H3F2N
and a molecular weight of 103.07 g/mol. Its IUPAC name is 3,3-difluoropyrrole.
Molecular Properties
| Compound Name | 3,3-difluoropyrrole |
| PubChem CID | 91281361 |
| Molecular Formula | C4H3F2N |
| Molecular Weight | 103.07 g/mol |
| Exact Mass | 103.02 |
| IUPAC Name | 3,3-difluoropyrrole |
| SMILES | FC1(F)C=CN=C1 |
| InChI | InChI=1S/C4H3F2N/c5-4(6)1-2-7-3-4/h1-3H |
| InChIKey | YACOAXKLUZNRTM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.07 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoropyrrole?
The IUPAC name of 3,3-difluoropyrrole (CID 91281361) is 3,3-difluoropyrrole.
What is the SMILES notation for 3,3-difluoropyrrole?
The canonical SMILES for 3,3-difluoropyrrole is FC1(F)C=CN=C1.
What is the InChIKey of 3,3-difluoropyrrole?
The InChIKey is YACOAXKLUZNRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F2N/c5-4(6)1-2-7-3-4/h1-3H.
What are the key properties of 3,3-difluoropyrrole?
3,3-difluoropyrrole has a molecular weight of 103.07 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoropyrrole is sourced from PubChem (CID 91281361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).