About bis(N,N-dimethylethanamine);naphthalene
bis(N,N-dimethylethanamine);naphthalene (PubChem CID 91281555) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is bis(N,N-dimethylethanamine);naphthalene.
Molecular Properties
| Compound Name | bis(N,N-dimethylethanamine);naphthalene |
| PubChem CID | 91281555 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | bis(N,N-dimethylethanamine);naphthalene |
| SMILES | CCN(C)C.CCN(C)C.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C4H11N/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-4-5(2)3/h1-8H;2*4H2,1-3H3 |
| InChIKey | KQNYNENKASFPGJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(N,N-dimethylethanamine);naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N,N-dimethylethanamine);naphthalene?
The IUPAC name of bis(N,N-dimethylethanamine);naphthalene (CID 91281555) is bis(N,N-dimethylethanamine);naphthalene.
What is the SMILES notation for bis(N,N-dimethylethanamine);naphthalene?
The canonical SMILES for bis(N,N-dimethylethanamine);naphthalene is CCN(C)C.CCN(C)C.c1ccc2ccccc2c1.
What is the InChIKey of bis(N,N-dimethylethanamine);naphthalene?
The InChIKey is KQNYNENKASFPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C4H11N/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-4-5(2)3/h1-8H;2*4H2,1-3H3.
What are the key properties of bis(N,N-dimethylethanamine);naphthalene?
bis(N,N-dimethylethanamine);naphthalene has a molecular weight of 274.45 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N,N-dimethylethanamine);naphthalene is sourced from PubChem (CID 91281555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).