C8H18O5 — CID 91281717
(2S,4S)-2,3,4-trimethoxypentane-1,5-diol (PubChem CID 91281717) has the molecular formula C8H18O5 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S,4S)-2,3,4-trimethoxypentane-1,5-diol.
| Compound Name | (2S,4S)-2,3,4-trimethoxypentane-1,5-diol |
|---|---|
| PubChem CID | 91281717 |
| Molecular Formula | C8H18O5 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (2S,4S)-2,3,4-trimethoxypentane-1,5-diol |
| SMILES | COC([C@H](CO)OC)[C@H](CO)OC |
| InChI | InChI=1S/C8H18O5/c1-11-6(4-9)8(13-3)7(5-10)12-2/h6-10H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | UKEFEULBEWFWLP-BQBZGAKWSA-N |
| XLogP | -0.98 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |