About (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate
(1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 91281838) has the molecular formula C21H24N2O4S
and a molecular weight of 400.50 g/mol. Its IUPAC name is (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 91281838 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CC(=O)c1ccccc1-c1nc(C(=O)OC2(C(N)=O)CCCCCCC2)cs1 |
| InChI | InChI=1S/C21H24N2O4S/c1-14(24)15-9-5-6-10-16(15)18-23-17(13-28-18)19(25)27-21(20(22)26)11-7-3-2-4-8-12-21/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3,(H2,22,26) |
| InChIKey | WTQPCGFCRLXIAA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate (CID 91281838) is (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate is CC(=O)c1ccccc1-c1nc(C(=O)OC2(C(N)=O)CCCCCCC2)cs1.
What is the InChIKey of (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate?
The InChIKey is WTQPCGFCRLXIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4S/c1-14(24)15-9-5-6-10-16(15)18-23-17(13-28-18)19(25)27-21(20(22)26)11-7-3-2-4-8-12-21/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3,(H2,22,26).
What are the key properties of (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate?
(1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate has a molecular weight of 400.50 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclooctyl) 2-(2-acetylphenyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 91281838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).